C32H28N2O2 — CID 20598573
4-pyrrol-1-yl-1-[4-(4-pyrrol-1-ylbutanoyl)fluoranthen-8-yl]butan-1-one (PubChem CID 20598573) has the molecular formula C32H28N2O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 4-pyrrol-1-yl-1-[4-(4-pyrrol-1-ylbutanoyl)fluoranthen-8-yl]butan-1-one.
| Compound Name | 4-pyrrol-1-yl-1-[4-(4-pyrrol-1-ylbutanoyl)fluoranthen-8-yl]butan-1-one |
|---|---|
| PubChem CID | 20598573 |
| Molecular Formula | C32H28N2O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-pyrrol-1-yl-1-[4-(4-pyrrol-1-ylbutanoyl)fluoranthen-8-yl]butan-1-one |
| SMILES | O=C(CCCn1cccc1)c1ccc2c(c1)-c1ccc(C(=O)CCCn3cccc3)c3cccc-2c13 |
| InChI | InChI=1S/C32H28N2O2/c35-30(10-6-20-33-16-1-2-17-33)23-12-13-24-26-8-5-9-27-25(14-15-28(32(26)27)29(24)22-23)31(36)11-7-21-34-18-3-4-19-34/h1-5,8-9,12-19,22H,6-7,10-11,20-21H2 |
| InChIKey | KKIYSUNCHNYSSD-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |