C18H23NO6 — CID 20599320
[(1S)-1-[(3S,6R,7S,7aS)-6,7-dihydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate (PubChem CID 20599320) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [(1S)-1-[(3S,6R,7S,7aS)-6,7-dihydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate.
| Compound Name | [(1S)-1-[(3S,6R,7S,7aS)-6,7-dihydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 20599320 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(1S)-1-[(3S,6R,7S,7aS)-6,7-dihydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate |
| SMILES | CC(=O)O[C@@H](C(C)C)[C@@]12CO[C@@H](c3ccccc3)N1C(=O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C18H23NO6/c1-10(2)15(25-11(3)20)18-9-24-17(12-7-5-4-6-8-12)19(18)16(23)13(21)14(18)22/h4-8,10,13-15,17,21-22H,9H2,1-3H3/t13-,14-,15+,17+,18+/m1/s1 |
| InChIKey | RKHZIQYBXIEGPS-YONAWACDSA-N |
| XLogP | 0.61 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |