C18H23NO5 — CID 20599323
[(1S)-1-[(3S,7S,7aS)-7-hydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate (PubChem CID 20599323) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [(1S)-1-[(3S,7S,7aS)-7-hydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate.
| Compound Name | [(1S)-1-[(3S,7S,7aS)-7-hydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 20599323 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(1S)-1-[(3S,7S,7aS)-7-hydroxy-5-oxo-3-phenyl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-7a-yl]-2-methylpropyl] acetate |
| SMILES | CC(=O)O[C@@H](C(C)C)[C@@]12CO[C@@H](c3ccccc3)N1C(=O)C[C@@H]2O |
| InChI | InChI=1S/C18H23NO5/c1-11(2)16(24-12(3)20)18-10-23-17(13-7-5-4-6-8-13)19(18)15(22)9-14(18)21/h4-8,11,14,16-17,21H,9-10H2,1-3H3/t14-,16-,17-,18-/m0/s1 |
| InChIKey | TWMGVYVAHPBDNK-DKIMLUQUSA-N |
| XLogP | 1.64 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |