C27H42F2O2 — CID 20599468
2-(2,2-difluoroethenyl)-5-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]-1,3-dioxane (PubChem CID 20599468) has the molecular formula C27H42F2O2 and a molecular weight of 436.63 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-(2,2-difluoroethenyl)-5-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599468 |
| Molecular Formula | C27H42F2O2 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-[4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]-1,3-dioxane |
| SMILES | C/C=C/C1CCC(C2CCC(C3CCC(C4COC(C=C(F)F)OC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C27H42F2O2/c1-2-3-19-4-6-20(7-5-19)21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-17-30-27(31-18-25)16-26(28)29/h2-3,16,19-25,27H,4-15,17-18H2,1H3/b3-2+ |
| InChIKey | HWDULYZQUAFKHA-NSCUHMNNSA-N |
| XLogP | 7.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|