C22H34F2O4 — CID 20599479
2-(3,3-difluoroprop-2-enyl)-5-[5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxan-2-yl]-1,3-dioxane (PubChem CID 20599479) has the molecular formula C22H34F2O4 and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-(3,3-difluoroprop-2-enyl)-5-[5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxan-2-yl]-1,3-dioxane.
| Compound Name | 2-(3,3-difluoroprop-2-enyl)-5-[5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599479 |
| Molecular Formula | C22H34F2O4 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-(3,3-difluoroprop-2-enyl)-5-[5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxan-2-yl]-1,3-dioxane |
| SMILES | CCC/C=C/C1CCC(C2COC(C3COC(CC=C(F)F)OC3)OC2)CC1 |
| InChI | InChI=1S/C22H34F2O4/c1-2-3-4-5-16-6-8-17(9-7-16)18-12-27-22(28-13-18)19-14-25-21(26-15-19)11-10-20(23)24/h4-5,10,16-19,21-22H,2-3,6-9,11-15H2,1H3/b5-4+ |
| InChIKey | DVPLXMQVKQSMMN-SNAWJCMRSA-N |
| XLogP | 5.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|