C21H34F2O5 — CID 20599481
2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-pentoxy-1,3-dioxan-2-yl)-1,3-dioxane (PubChem CID 20599481) has the molecular formula C21H34F2O5 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-pentoxy-1,3-dioxan-2-yl)-1,3-dioxane.
| Compound Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-pentoxy-1,3-dioxan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599481 |
| Molecular Formula | C21H34F2O5 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-(5-pentoxy-1,3-dioxan-2-yl)-1,3-dioxane |
| SMILES | CCCCCOC1COC(C2COC(C3CCC(C=C(F)F)CC3)OC2)OC1 |
| InChI | InChI=1S/C21H34F2O5/c1-2-3-4-9-24-18-13-27-21(28-14-18)17-11-25-20(26-12-17)16-7-5-15(6-8-16)10-19(22)23/h10,15-18,20-21H,2-9,11-14H2,1H3 |
| InChIKey | KAOCJDOIFYZFHU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|