C19H28F2O4 — CID 20599482
2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane (PubChem CID 20599482) has the molecular formula C19H28F2O4 and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane.
| Compound Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599482 |
| Molecular Formula | C19H28F2O4 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-[4-(2,2-difluoroethenyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(C2COC(C3CCC(C=C(F)F)CC3)OC2)OC1 |
| InChI | InChI=1S/C19H28F2O4/c1-2-3-14-9-22-19(23-10-14)16-11-24-18(25-12-16)15-6-4-13(5-7-15)8-17(20)21/h2-3,8,13-16,18-19H,4-7,9-12H2,1H3/b3-2+ |
| InChIKey | ACSMTLDMYNCGCA-NSCUHMNNSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|