C27H44F2O4 — CID 20599494
2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane (PubChem CID 20599494) has the molecular formula C27H44F2O4 and a molecular weight of 470.64 g/mol. Its IUPAC name is 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane.
| Compound Name | 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 20599494 |
| Molecular Formula | C27H44F2O4 |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 2-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane |
| SMILES | CCCCCC1COC(C2COC(C3CCC(C4CCC(C=C(F)F)CC4)CC3)OC2)OC1 |
| InChI | InChI=1S/C27H44F2O4/c1-2-3-4-5-20-15-30-27(31-16-20)24-17-32-26(33-18-24)23-12-10-22(11-13-23)21-8-6-19(7-9-21)14-25(28)29/h14,19-24,26-27H,2-13,15-18H2,1H3 |
| InChIKey | WMKXOSJSYROKKK-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|