C28H44F2O2 — CID 20599511
2-[(E)-2-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-methyl-1,3-dioxane (PubChem CID 20599511) has the molecular formula C28H44F2O2 and a molecular weight of 450.65 g/mol. Its IUPAC name is 2-[(E)-2-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[(E)-2-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 20599511 |
| Molecular Formula | C28H44F2O2 |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 2-[(E)-2-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]cyclohexyl]ethenyl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(/C=C/C2CCC(C3CCC(C4CCC(CC=C(F)F)CC4)CC3)CC2)OC1 |
| InChI | InChI=1S/C28H44F2O2/c1-20-18-31-28(32-19-20)17-7-22-4-10-24(11-5-22)26-14-12-25(13-15-26)23-8-2-21(3-9-23)6-16-27(29)30/h7,16-17,20-26,28H,2-6,8-15,18-19H2,1H3/b17-7+ |
| InChIKey | BAXVLPUJYRHTGU-REZTVBANSA-N |
| XLogP | 8.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|