C24H38F2O3 — CID 20599514
2-[(E)-2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]ethenyl]-5-ethoxy-1,3-dioxane (PubChem CID 20599514) has the molecular formula C24H38F2O3 and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[(E)-2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]ethenyl]-5-ethoxy-1,3-dioxane.
| Compound Name | 2-[(E)-2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]ethenyl]-5-ethoxy-1,3-dioxane |
|---|---|
| PubChem CID | 20599514 |
| Molecular Formula | C24H38F2O3 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 2-[(E)-2-[4-[4-(4,4-difluorobut-3-enyl)cyclohexyl]cyclohexyl]ethenyl]-5-ethoxy-1,3-dioxane |
| SMILES | CCOC1COC(/C=C/C2CCC(C3CCC(CCC=C(F)F)CC3)CC2)OC1 |
| InChI | InChI=1S/C24H38F2O3/c1-2-27-22-16-28-24(29-17-22)15-10-19-8-13-21(14-9-19)20-11-6-18(7-12-20)4-3-5-23(25)26/h5,10,15,18-22,24H,2-4,6-9,11-14,16-17H2,1H3/b15-10+ |
| InChIKey | UCDZLGUBFKVOII-XNTDXEJSSA-N |
| XLogP | 6.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|