C21H32F2O4 — CID 20599517
2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane (PubChem CID 20599517) has the molecular formula C21H32F2O4 and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane.
| Compound Name | 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599517 |
| Molecular Formula | C21H32F2O4 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-[5-[(E)-prop-1-enyl]-1,3-dioxan-2-yl]-1,3-dioxane |
| SMILES | C/C=C/C1COC(C2COC(C3CCC(CCC=C(F)F)CC3)OC2)OC1 |
| InChI | InChI=1S/C21H32F2O4/c1-2-4-16-11-24-21(25-12-16)18-13-26-20(27-14-18)17-9-7-15(8-10-17)5-3-6-19(22)23/h2,4,6,15-18,20-21H,3,5,7-14H2,1H3/b4-2+ |
| InChIKey | OCGJAYGEBBAILW-DUXPYHPUSA-N |
| XLogP | 4.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|