C25H40F2O2 — CID 20599520
2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane (PubChem CID 20599520) has the molecular formula C25H40F2O2 and a molecular weight of 410.59 g/mol. Its IUPAC name is 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20599520 |
| Molecular Formula | C25H40F2O2 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 2-[2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]ethyl]-5-[4-[(E)-prop-1-enyl]cyclohexyl]-1,3-dioxane |
| SMILES | C/C=C/C1CCC(C2COC(CCC3CCC(CCC=C(F)F)CC3)OC2)CC1 |
| InChI | InChI=1S/C25H40F2O2/c1-2-4-19-11-14-22(15-12-19)23-17-28-25(29-18-23)16-13-21-9-7-20(8-10-21)5-3-6-24(26)27/h2,4,6,19-23,25H,3,5,7-18H2,1H3/b4-2+ |
| InChIKey | GUMONIRNLJWGED-DUXPYHPUSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|