About 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane
2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane (PubChem CID 20599684) has the molecular formula C20H34F2O
and a molecular weight of 328.49 g/mol. Its IUPAC name is 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane.
Molecular Properties
| Compound Name | 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane |
| PubChem CID | 20599684 |
| Molecular Formula | C20H34F2O |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(C2CCC(CCC=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C20H34F2O/c1-2-3-4-6-17-11-14-19(23-15-17)18-12-9-16(10-13-18)7-5-8-20(21)22/h8,16-19H,2-7,9-15H2,1H3 |
| InChIKey | KCHCTEHHIQXEJW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane?
The IUPAC name of 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane (CID 20599684) is 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane.
What is the SMILES notation for 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane?
The canonical SMILES for 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane is CCCCCC1CCC(C2CCC(CCC=C(F)F)CC2)OC1.
What is the InChIKey of 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane?
The InChIKey is KCHCTEHHIQXEJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34F2O/c1-2-3-4-6-17-11-14-19(23-15-17)18-12-9-16(10-13-18)7-5-8-20(21)22/h8,16-19H,2-7,9-15H2,1H3.
What are the key properties of 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane?
2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane has a molecular weight of 328.49 g/mol, XLogP of 6.73, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4,4-difluorobut-3-enyl)cyclohexyl]-5-pentyloxane is sourced from PubChem (CID 20599684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).