About 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one
4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one (PubChem CID 20599793) has the molecular formula C17H26F2O2
and a molecular weight of 300.39 g/mol. Its IUPAC name is 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one |
| PubChem CID | 20599793 |
| Molecular Formula | C17H26F2O2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one |
| SMILES | O=C1CCC(CCC2CCC(CCC=C(F)F)CO2)CC1 |
| InChI | InChI=1S/C17H26F2O2/c18-17(19)3-1-2-14-7-11-16(21-12-14)10-6-13-4-8-15(20)9-5-13/h3,13-14,16H,1-2,4-12H2 |
| InChIKey | NQENFUQMDGZRGC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one?
The IUPAC name of 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one (CID 20599793) is 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one.
What is the SMILES notation for 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one?
The canonical SMILES for 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one is O=C1CCC(CCC2CCC(CCC=C(F)F)CO2)CC1.
What is the InChIKey of 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one?
The InChIKey is NQENFUQMDGZRGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26F2O2/c18-17(19)3-1-2-14-7-11-16(21-12-14)10-6-13-4-8-15(20)9-5-13/h3,13-14,16H,1-2,4-12H2.
What are the key properties of 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one?
4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one has a molecular weight of 300.39 g/mol, XLogP of 4.88, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[5-(4,4-difluorobut-3-enyl)oxan-2-yl]ethyl]cyclohexan-1-one is sourced from PubChem (CID 20599793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).