About 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one
4-(7,7-difluorohept-6-enyl)cyclohexan-1-one (PubChem CID 20599854) has the molecular formula C13H20F2O
and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one |
| PubChem CID | 20599854 |
| Molecular Formula | C13H20F2O |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one |
| SMILES | O=C1CCC(CCCCCC=C(F)F)CC1 |
| InChI | InChI=1S/C13H20F2O/c14-13(15)6-4-2-1-3-5-11-7-9-12(16)10-8-11/h6,11H,1-5,7-10H2 |
| InChIKey | REIKUDSQUVUUPR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one?
The IUPAC name of 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one (CID 20599854) is 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one.
What is the SMILES notation for 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one?
The canonical SMILES for 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one is O=C1CCC(CCCCCC=C(F)F)CC1.
What is the InChIKey of 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one?
The InChIKey is REIKUDSQUVUUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2O/c14-13(15)6-4-2-1-3-5-11-7-9-12(16)10-8-11/h6,11H,1-5,7-10H2.
What are the key properties of 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one?
4-(7,7-difluorohept-6-enyl)cyclohexan-1-one has a molecular weight of 230.30 g/mol, XLogP of 4.48, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one is sourced from PubChem (CID 20599854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).