C13H20F2O — CID 20599854
4-(7,7-difluorohept-6-enyl)cyclohexan-1-one (PubChem CID 20599854) has the molecular formula C13H20F2O and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one.
| Compound Name | 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 20599854 |
| Molecular Formula | C13H20F2O |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-(7,7-difluorohept-6-enyl)cyclohexan-1-one |
| SMILES | O=C1CCC(CCCCCC=C(F)F)CC1 |
| InChI | InChI=1S/C13H20F2O/c14-13(15)6-4-2-1-3-5-11-7-9-12(16)10-8-11/h6,11H,1-5,7-10H2 |
| InChIKey | REIKUDSQUVUUPR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|