About 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane
5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane (PubChem CID 20599945) has the molecular formula C24H38F2O
and a molecular weight of 380.56 g/mol. Its IUPAC name is 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane.
Molecular Properties
| Compound Name | 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane |
| PubChem CID | 20599945 |
| Molecular Formula | C24H38F2O |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane |
| SMILES | C/C=C/CCC1CCC(C2CCC(C3CCC(C=C(F)F)CC3)CC2)CO1 |
| InChI | InChI=1S/C24H38F2O/c1-2-3-4-5-23-15-14-22(17-27-23)21-12-10-20(11-13-21)19-8-6-18(7-9-19)16-24(25)26/h2-3,16,18-23H,4-15,17H2,1H3/b3-2+ |
| InChIKey | ZHKIBVHAYMPQJK-NSCUHMNNSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane?
The IUPAC name of 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane (CID 20599945) is 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane.
What is the SMILES notation for 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane?
The canonical SMILES for 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane is C/C=C/CCC1CCC(C2CCC(C3CCC(C=C(F)F)CC3)CC2)CO1.
What is the InChIKey of 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane?
The InChIKey is ZHKIBVHAYMPQJK-NSCUHMNNSA-N. The full InChI is InChI=1S/C24H38F2O/c1-2-3-4-5-23-15-14-22(17-27-23)21-12-10-20(11-13-21)19-8-6-18(7-9-19)16-24(25)26/h2-3,16,18-23H,4-15,17H2,1H3/b3-2+.
What are the key properties of 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane?
5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane has a molecular weight of 380.56 g/mol, XLogP of 7.53, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[4-(2,2-difluoroethenyl)cyclohexyl]cyclohexyl]-2-[(E)-pent-3-enyl]oxane is sourced from PubChem (CID 20599945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).