About Hexose
Hexose (PubChem CID 206) has the molecular formula C6H12O6
and a molecular weight of 180.16 g/mol. Its IUPAC name is 6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
Molecular Properties
| Compound Name | Hexose |
| PubChem CID | 206 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | C(C1C(C(C(C(O1)O)O)O)O)O |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2 |
| InChIKey | WQZGKKKJIJFFOK-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 151 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Hexose with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hexose?
The IUPAC name of Hexose (CID 206) is 6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
What is the SMILES notation for Hexose?
The canonical SMILES for Hexose is C(C1C(C(C(C(O1)O)O)O)O)O.
What is the InChIKey of Hexose?
The InChIKey is WQZGKKKJIJFFOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2.
What are the key properties of Hexose?
Hexose has a molecular weight of 180.16 g/mol, XLogP of -2.60, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Hexose is sourced from PubChem (CID 206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).