C17H22F2O2 — CID 20600018
5-[4-(4,4-difluorobut-3-enyl)phenyl]-2-propyl-1,3-dioxane (PubChem CID 20600018) has the molecular formula C17H22F2O2 and a molecular weight of 296.36 g/mol. Its IUPAC name is 5-[4-(4,4-difluorobut-3-enyl)phenyl]-2-propyl-1,3-dioxane.
| Compound Name | 5-[4-(4,4-difluorobut-3-enyl)phenyl]-2-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20600018 |
| Molecular Formula | C17H22F2O2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-[4-(4,4-difluorobut-3-enyl)phenyl]-2-propyl-1,3-dioxane |
| SMILES | CCCC1OCC(c2ccc(CCC=C(F)F)cc2)CO1 |
| InChI | InChI=1S/C17H22F2O2/c1-2-4-17-20-11-15(12-21-17)14-9-7-13(8-10-14)5-3-6-16(18)19/h6-10,15,17H,2-5,11-12H2,1H3 |
| InChIKey | ZNONIYRPWVHCPZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |