About 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane
5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane (PubChem CID 20600025) has the molecular formula C26H42F2O
and a molecular weight of 408.62 g/mol. Its IUPAC name is 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane.
Molecular Properties
| Compound Name | 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane |
| PubChem CID | 20600025 |
| Molecular Formula | C26H42F2O |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane |
| SMILES | C/C=C/C1CCC(CCC2CCC(C3CCC(CCC=C(F)F)CO3)CC2)CC1 |
| InChI | InChI=1S/C26H42F2O/c1-2-4-20-7-9-21(10-8-20)11-12-22-13-16-24(17-14-22)25-18-15-23(19-29-25)5-3-6-26(27)28/h2,4,6,20-25H,3,5,7-19H2,1H3/b4-2+ |
| InChIKey | DHSHZJMEOKINQX-DUXPYHPUSA-N |
| XLogP | 8.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane?
The IUPAC name of 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane (CID 20600025) is 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane.
What is the SMILES notation for 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane?
The canonical SMILES for 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane is C/C=C/C1CCC(CCC2CCC(C3CCC(CCC=C(F)F)CO3)CC2)CC1.
What is the InChIKey of 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane?
The InChIKey is DHSHZJMEOKINQX-DUXPYHPUSA-N. The full InChI is InChI=1S/C26H42F2O/c1-2-4-20-7-9-21(10-8-20)11-12-22-13-16-24(17-14-22)25-18-15-23(19-29-25)5-3-6-26(27)28/h2,4,6,20-25H,3,5,7-19H2,1H3/b4-2+.
What are the key properties of 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane?
5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane has a molecular weight of 408.62 g/mol, XLogP of 8.31, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-difluorobut-3-enyl)-2-[4-[2-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]oxane is sourced from PubChem (CID 20600025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).