C31H37N5O8 — CID 20600179
(2,4,6-trimethylcyclohexyl) 5-[bis(2-methoxy-2-oxoethyl)carbamoyloxy]-2-(3,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20600179) has the molecular formula C31H37N5O8 and a molecular weight of 607.66 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-[bis(2-methoxy-2-oxoethyl)carbamoyloxy]-2-(3,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-[bis(2-methoxy-2-oxoethyl)carbamoyloxy]-2-(3,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20600179 |
| Molecular Formula | C31H37N5O8 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-[bis(2-methoxy-2-oxoethyl)carbamoyloxy]-2-(3,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3cc(C)cc(C)c3)[nH]n2c1OC(=O)N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C31H37N5O8/c1-16-9-17(2)13-21(12-16)27-33-28-24(30(39)43-26-19(4)10-18(3)11-20(26)5)25(32-6)29(36(28)34-27)44-31(40)35(14-22(37)41-7)15-23(38)42-8/h9,12-13,18-20,26H,10-11,14-15H2,1-5,7-8H3,(H,33,34) |
| InChIKey | DKNIFIOOXPKMRB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|