C28H35N5O5 — CID 20600191
2-[[6-isocyano-2-(4-methylphenyl)-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(methoxymethyl)amino]acetic acid (PubChem CID 20600191) has the molecular formula C28H35N5O5 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[[6-isocyano-2-(4-methylphenyl)-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(methoxymethyl)amino]acetic acid.
| Compound Name | 2-[[6-isocyano-2-(4-methylphenyl)-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(methoxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 20600191 |
| Molecular Formula | C28H35N5O5 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 2-[[6-isocyano-2-(4-methylphenyl)-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(methoxymethyl)amino]acetic acid |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(C)cc3)[nH]n2c1CN(COC)CC(=O)O |
| InChI | InChI=1S/C28H35N5O5/c1-16-7-9-20(10-8-16)26-30-27-23(28(36)38-25-18(3)11-17(2)12-19(25)4)24(29-5)21(33(27)31-26)13-32(15-37-6)14-22(34)35/h7-10,17-19,25H,11-15H2,1-4,6H3,(H,30,31)(H,34,35) |
| InChIKey | YKTMRPXQEPUZHM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|