C20H15ClF3N5O3 — CID 20600200
[3-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 2,3,4-trifluorobenzoate (PubChem CID 20600200) has the molecular formula C20H15ClF3N5O3 and a molecular weight of 465.82 g/mol. Its IUPAC name is [3-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 2,3,4-trifluorobenzoate.
| Compound Name | [3-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 2,3,4-trifluorobenzoate |
|---|---|
| PubChem CID | 20600200 |
| Molecular Formula | C20H15ClF3N5O3 |
| Molecular Weight | 465.82 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [3-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 2,3,4-trifluorobenzoate |
| SMILES | Cc1[nH]n2nc(-c3cccc(NCOCOC(=O)c4ccc(F)c(F)c4F)c3)nc2c1Cl |
| InChI | InChI=1S/C20H15ClF3N5O3/c1-10-15(21)19-26-18(28-29(19)27-10)11-3-2-4-12(7-11)25-8-31-9-32-20(30)13-5-6-14(22)17(24)16(13)23/h2-7,25,27H,8-9H2,1H3 |
| InChIKey | IHDUGJVOCHLTFG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|