C19H24ClN5O3 — CID 20600229
[4-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylpentanoate (PubChem CID 20600229) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is [4-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylpentanoate.
| Compound Name | [4-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylpentanoate |
|---|---|
| PubChem CID | 20600229 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [4-(7-chloro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylpentanoate |
| SMILES | Cc1[nH]n2nc(-c3ccc(NCOCOC(=O)CCC(C)C)cc3)nc2c1Cl |
| InChI | InChI=1S/C19H24ClN5O3/c1-12(2)4-9-16(26)28-11-27-10-21-15-7-5-14(6-8-15)18-22-19-17(20)13(3)23-25(19)24-18/h5-8,12,21,23H,4,9-11H2,1-3H3 |
| InChIKey | ANQJGXDBQNHQDW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|