C24H33FN6O5 — CID 20600235
[4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 11-nitroundecanoate (PubChem CID 20600235) has the molecular formula C24H33FN6O5 and a molecular weight of 504.56 g/mol. Its IUPAC name is [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 11-nitroundecanoate.
| Compound Name | [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 11-nitroundecanoate |
|---|---|
| PubChem CID | 20600235 |
| Molecular Formula | C24H33FN6O5 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 11-nitroundecanoate |
| SMILES | Cc1[nH]n2nc(-c3ccc(NCOCOC(=O)CCCCCCCCCC[N+](=O)[O-])cc3)nc2c1F |
| InChI | InChI=1S/C24H33FN6O5/c1-18-22(25)24-27-23(29-31(24)28-18)19-11-13-20(14-12-19)26-16-35-17-36-21(32)10-8-6-4-2-3-5-7-9-15-30(33)34/h11-14,26,28H,2-10,15-17H2,1H3 |
| InChIKey | XJEHKKVRXSSTPX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|