C21H26FN5O3 — CID 20600236
[4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylcyclohexane-1-carboxylate (PubChem CID 20600236) has the molecular formula C21H26FN5O3 and a molecular weight of 415.47 g/mol. Its IUPAC name is [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylcyclohexane-1-carboxylate.
| Compound Name | [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20600236 |
| Molecular Formula | C21H26FN5O3 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [4-(7-fluoro-6-methyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)anilino]methoxymethyl 4-methylcyclohexane-1-carboxylate |
| SMILES | Cc1[nH]n2nc(-c3ccc(NCOCOC(=O)C4CCC(C)CC4)cc3)nc2c1F |
| InChI | InChI=1S/C21H26FN5O3/c1-13-3-5-16(6-4-13)21(28)30-12-29-11-23-17-9-7-15(8-10-17)19-24-20-18(22)14(2)25-27(20)26-19/h7-10,13,16,23,25H,3-6,11-12H2,1-2H3 |
| InChIKey | CJJPFLUBLLOSMO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|