C36H42N6O5S — CID 20600274
1-[2-[(2,5-dimethylphenoxy)sulfanylamino]-4-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]phenyl]piperidine-3-carboxylic acid (PubChem CID 20600274) has the molecular formula C36H42N6O5S and a molecular weight of 670.84 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenoxy)sulfanylamino]-4-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]phenyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[(2,5-dimethylphenoxy)sulfanylamino]-4-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]phenyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 20600274 |
| Molecular Formula | C36H42N6O5S |
| Molecular Weight | 670.84 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenoxy)sulfanylamino]-4-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]phenyl]piperidine-3-carboxylic acid |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(N4CCCC(C(=O)O)C4)c(NSOc4cc(C)ccc4C)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C36H42N6O5S/c1-20-9-10-22(3)30(16-20)47-48-40-27-17-25(11-12-29(27)41-13-7-8-26(18-41)35(43)44)33-38-34-31(28(37-6)19-42(34)39-33)36(45)46-32-23(4)14-21(2)15-24(32)5/h9-12,16-17,19,21,23-24,26,32,40H,7-8,13-15,18H2,1-5H3,(H,38,39)(H,43,44) |
| InChIKey | ALLFOSFPDXVSGX-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.84 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|