C22H17FN2O6S3 — CID 20600329
3-[2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 20600329) has the molecular formula C22H17FN2O6S3 and a molecular weight of 520.59 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20600329 |
| Molecular Formula | C22H17FN2O6S3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 3-[2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]furo[3,2-e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | O=C(O)CN1/C(=C/c2sc3ccc4occc4c3[n+]2CCCS(=O)(=O)[O-])Sc2ccc(F)cc21 |
| InChI | InChI=1S/C22H17FN2O6S3/c23-13-2-4-17-15(10-13)25(12-21(26)27)20(32-17)11-19-24(7-1-9-34(28,29)30)22-14-6-8-31-16(14)3-5-18(22)33-19/h2-6,8,10-11H,1,7,9,12H2,(H-,26,27,28,29,30) |
| InChIKey | ZHOIHINLSHEVJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|