C21H14FN2O5S2+ — CID 20600331
2-[(2Z)-2-[[1-(carboxymethyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid (PubChem CID 20600331) has the molecular formula C21H14FN2O5S2+ and a molecular weight of 457.48 g/mol. Its IUPAC name is 2-[(2Z)-2-[[1-(carboxymethyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[(2Z)-2-[[1-(carboxymethyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 20600331 |
| Molecular Formula | C21H14FN2O5S2+ |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 2-[(2Z)-2-[[1-(carboxymethyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-5-fluoro-1,3-benzothiazol-3-yl]acetic acid |
| SMILES | O=C(O)CN1/C(=C/c2sc3ccc4occc4c3[n+]2CC(=O)O)Sc2ccc(F)cc21 |
| InChI | InChI=1S/C21H13FN2O5S2/c22-11-1-3-15-13(7-11)23(9-19(25)26)17(30-15)8-18-24(10-20(27)28)21-12-5-6-29-14(12)2-4-16(21)31-18/h1-8H,9-10H2,(H-,25,26,27,28)/p+1 |
| InChIKey | BWBAEAUREMTOCX-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|