About 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium
2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium (PubChem CID 20600359) has the molecular formula C10H10NOS+
and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium.
Molecular Properties
| Compound Name | 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium |
| PubChem CID | 20600359 |
| Molecular Formula | C10H10NOS+ |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium |
| SMILES | Cc1[nH+]c2c(s1)CCc1occc1-2 |
| InChI | InChI=1S/C10H9NOS/c1-6-11-10-7-4-5-12-8(7)2-3-9(10)13-6/h4-5H,2-3H2,1H3/p+1 |
| InChIKey | CADJIWPFOYMHNU-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 27.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium?
The IUPAC name of 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium (CID 20600359) is 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium.
What is the SMILES notation for 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium?
The canonical SMILES for 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium is Cc1[nH+]c2c(s1)CCc1occc1-2.
What is the InChIKey of 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium?
The InChIKey is CADJIWPFOYMHNU-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H9NOS/c1-6-11-10-7-4-5-12-8(7)2-3-9(10)13-6/h4-5H,2-3H2,1H3/p+1.
What are the key properties of 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium?
2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium has a molecular weight of 192.26 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-dihydrofuro[3,2-e][1,3]benzothiazol-1-ium is sourced from PubChem (CID 20600359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).