C39H71NO4 — CID 20600653
11,14,16,20,22,28,34-heptamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione (PubChem CID 20600653) has the molecular formula C39H71NO4 and a molecular weight of 618.00 g/mol. Its IUPAC name is 11,14,16,20,22,28,34-heptamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione.
| Compound Name | 11,14,16,20,22,28,34-heptamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione |
|---|---|
| PubChem CID | 20600653 |
| Molecular Formula | C39H71NO4 |
| Molecular Weight | 618.00 g/mol |
| Exact Mass | 617.54 |
| IUPAC Name | 11,14,16,20,22,28,34-heptamethyl-10,35-dioxa-4-azatricyclo[29.3.1.04,8]pentatriacontane-3,9-dione |
| SMILES | CC1CCCCCC(C)CC(C)CCCC(C)CC(C)CCC(C)OC(=O)C2CCCN2C(=O)CC2OC(CC1)CCC2C |
| InChI | InChI=1S/C39H71NO4/c1-28-13-9-8-10-14-29(2)25-30(3)15-11-16-31(4)26-32(5)18-21-34(7)43-39(42)36-17-12-24-40(36)38(41)27-37-33(6)20-23-35(44-37)22-19-28/h28-37H,8-27H2,1-7H3 |
| InChIKey | CFCXYDMEMSMZQH-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.00 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |