C26H24Cl2F7N3O4 — CID 20601151
2-[1-[(2,4-dichlorophenyl)methyl]-5-[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-2-oxoethyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid (PubChem CID 20601151) has the molecular formula C26H24Cl2F7N3O4 and a molecular weight of 646.39 g/mol. Its IUPAC name is 2-[1-[(2,4-dichlorophenyl)methyl]-5-[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-2-oxoethyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid.
| Compound Name | 2-[1-[(2,4-dichlorophenyl)methyl]-5-[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-2-oxoethyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid |
|---|---|
| PubChem CID | 20601151 |
| Molecular Formula | C26H24Cl2F7N3O4 |
| Molecular Weight | 646.39 g/mol |
| Exact Mass | 645.10 |
| IUPAC Name | 2-[1-[(2,4-dichlorophenyl)methyl]-5-[2-(2,2,3,3,4,4,4-heptafluorobutylamino)-2-oxoethyl]-3-(4-methylphenyl)-2-oxo-1,3-diazinan-5-yl]acetic acid |
| SMILES | Cc1ccc(N2CC(CC(=O)O)(CC(=O)NCC(F)(F)C(F)(F)C(F)(F)F)CN(Cc3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C26H24Cl2F7N3O4/c1-15-2-6-18(7-3-15)38-14-23(10-21(40)41,9-20(39)36-12-24(29,30)25(31,32)26(33,34)35)13-37(22(38)42)11-16-4-5-17(27)8-19(16)28/h2-8H,9-14H2,1H3,(H,36,39)(H,40,41) |
| InChIKey | GRTTZISJTVNRKM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.39 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|