C14H16F3NO — CID 20601308
1-[3-(3,4,5-trifluorophenoxy)propyl]-3,6-dihydro-2H-pyridine (PubChem CID 20601308) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-[3-(3,4,5-trifluorophenoxy)propyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[3-(3,4,5-trifluorophenoxy)propyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 20601308 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-[3-(3,4,5-trifluorophenoxy)propyl]-3,6-dihydro-2H-pyridine |
| SMILES | Fc1cc(OCCCN2CC=CCC2)cc(F)c1F |
| InChI | InChI=1S/C14H16F3NO/c15-12-9-11(10-13(16)14(12)17)19-8-4-7-18-5-2-1-3-6-18/h1-2,9-10H,3-8H2 |
| InChIKey | WPVAYASLWDWNRD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|