C38H34ClN3O6 — CID 20601970
2-[[2-[4-[6-[4-[(2-chloro-6-methylpyridine-4-carbonyl)amino]cyclohexyl]oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid (PubChem CID 20601970) has the molecular formula C38H34ClN3O6 and a molecular weight of 664.16 g/mol. Its IUPAC name is 2-[[2-[4-[6-[4-[(2-chloro-6-methylpyridine-4-carbonyl)amino]cyclohexyl]oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[6-[4-[(2-chloro-6-methylpyridine-4-carbonyl)amino]cyclohexyl]oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20601970 |
| Molecular Formula | C38H34ClN3O6 |
| Molecular Weight | 664.16 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | 2-[[2-[4-[6-[4-[(2-chloro-6-methylpyridine-4-carbonyl)amino]cyclohexyl]oxynaphthalen-2-yl]oxyphenyl]acetyl]amino]benzoic acid |
| SMILES | Cc1cc(C(=O)NC2CCC(Oc3ccc4cc(Oc5ccc(CC(=O)Nc6ccccc6C(=O)O)cc5)ccc4c3)CC2)cc(Cl)n1 |
| InChI | InChI=1S/C38H34ClN3O6/c1-23-18-27(22-35(39)40-23)37(44)41-28-10-16-30(17-11-28)48-32-15-9-25-20-31(14-8-26(25)21-32)47-29-12-6-24(7-13-29)19-36(43)42-34-5-3-2-4-33(34)38(45)46/h2-9,12-15,18,20-22,28,30H,10-11,16-17,19H2,1H3,(H,41,44)(H,42,43)(H,45,46) |
| InChIKey | FPPAXBISBAYYKF-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.16 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|