C37H31F3N2O5S — CID 20602608
2-[[4-[6-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid (PubChem CID 20602608) has the molecular formula C37H31F3N2O5S and a molecular weight of 672.73 g/mol. Its IUPAC name is 2-[[4-[6-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid.
| Compound Name | 2-[[4-[6-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20602608 |
| Molecular Formula | C37H31F3N2O5S |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.19 |
| IUPAC Name | 2-[[4-[6-[4-[[4-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxynaphthalen-2-yl]oxybenzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc(Oc2ccc3cc(OC4CCC(NSc5ccc(C(F)(F)F)cc5)CC4)ccc3c2)cc1 |
| InChI | InChI=1S/C37H31F3N2O5S/c38-37(39,40)26-9-19-32(20-10-26)48-42-27-11-17-29(18-12-27)47-31-16-8-24-21-30(15-7-25(24)22-31)46-28-13-5-23(6-14-28)35(43)41-34-4-2-1-3-33(34)36(44)45/h1-10,13-16,19-22,27,29,42H,11-12,17-18H2,(H,41,43)(H,44,45) |
| InChIKey | QOFLQRXVRFENHR-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|