C37H53N5O9 — CID 20603062
(2,6-ditert-butyl-4-methylcyclohexyl) 5-[bis(2-methylperoxyethyl)carbamoyloxy]-6-isocyano-2-(4-methoxy-3-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20603062) has the molecular formula C37H53N5O9 and a molecular weight of 711.86 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 5-[bis(2-methylperoxyethyl)carbamoyloxy]-6-isocyano-2-(4-methoxy-3-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 5-[bis(2-methylperoxyethyl)carbamoyloxy]-6-isocyano-2-(4-methoxy-3-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20603062 |
| Molecular Formula | C37H53N5O9 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 5-[bis(2-methylperoxyethyl)carbamoyloxy]-6-isocyano-2-(4-methoxy-3-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C(C)(C)C)CC(C)CC2C(C)(C)C)c2nc(-c3ccc(OC)c(C)c3)[nH]n2c1OC(=O)N(CCOOC)CCOOC |
| InChI | InChI=1S/C37H53N5O9/c1-22-19-25(36(3,4)5)30(26(20-22)37(6,7)8)50-34(43)28-29(38-9)33(51-35(44)41(15-17-48-46-11)16-18-49-47-12)42-32(28)39-31(40-42)24-13-14-27(45-10)23(2)21-24/h13-14,21-22,25-26,30H,15-20H2,1-8,10-12H3,(H,39,40) |
| InChIKey | MPKZAMUBZNENRO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|