C10H24NO3+ — CID 20603111
[3-(2,3-dihydroxypropoxy)-2-methylpropyl]-trimethylazanium (PubChem CID 20603111) has the molecular formula C10H24NO3+ and a molecular weight of 206.31 g/mol. Its IUPAC name is [3-(2,3-dihydroxypropoxy)-2-methylpropyl]-trimethylazanium.
| Compound Name | [3-(2,3-dihydroxypropoxy)-2-methylpropyl]-trimethylazanium |
|---|---|
| PubChem CID | 20603111 |
| Molecular Formula | C10H24NO3+ |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | [3-(2,3-dihydroxypropoxy)-2-methylpropyl]-trimethylazanium |
| SMILES | CC(COCC(O)CO)C[N+](C)(C)C |
| InChI | InChI=1S/C10H24NO3/c1-9(5-11(2,3)4)7-14-8-10(13)6-12/h9-10,12-13H,5-8H2,1-4H3/q+1 |
| InChIKey | SYCNMJUXEZQMGX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|