C13H15F3O2 — CID 20603161
2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxane (PubChem CID 20603161) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxane.
| Compound Name | 2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20603161 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3-dioxane |
| SMILES | FC(F)(F)c1ccc(CCC2OCCCO2)cc1 |
| InChI | InChI=1S/C13H15F3O2/c14-13(15,16)11-5-2-10(3-6-11)4-7-12-17-8-1-9-18-12/h2-3,5-6,12H,1,4,7-9H2 |
| InChIKey | HVKDIDFDACHBAB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |