C14H36O2Si3 — CID 20603287
dimethyl-(2-trimethylsilyloxypropan-2-yl)-(2-trimethylsilylpropan-2-yloxy)silane (PubChem CID 20603287) has the molecular formula C14H36O2Si3 and a molecular weight of 320.70 g/mol. Its IUPAC name is dimethyl-(2-trimethylsilyloxypropan-2-yl)-(2-trimethylsilylpropan-2-yloxy)silane.
| Compound Name | dimethyl-(2-trimethylsilyloxypropan-2-yl)-(2-trimethylsilylpropan-2-yloxy)silane |
|---|---|
| PubChem CID | 20603287 |
| Molecular Formula | C14H36O2Si3 |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | dimethyl-(2-trimethylsilyloxypropan-2-yl)-(2-trimethylsilylpropan-2-yloxy)silane |
| SMILES | CC(C)(O[Si](C)(C)C(C)(C)O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H36O2Si3/c1-13(2,17(5,6)7)16-19(11,12)14(3,4)15-18(8,9)10/h1-12H3 |
| InChIKey | WPBJATDOBKEMKS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|