C15H36OSi2 — CID 20603290
trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilyloxypentan-2-yl)silane (PubChem CID 20603290) has the molecular formula C15H36OSi2 and a molecular weight of 288.62 g/mol. Its IUPAC name is trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilyloxypentan-2-yl)silane.
| Compound Name | trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilyloxypentan-2-yl)silane |
|---|---|
| PubChem CID | 20603290 |
| Molecular Formula | C15H36OSi2 |
| Molecular Weight | 288.62 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | trimethyl-(2,3,3,4-tetramethyl-4-trimethylsilyloxypentan-2-yl)silane |
| SMILES | CC(C)(O[Si](C)(C)C)C(C)(C)C(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C15H36OSi2/c1-13(2,15(5,6)17(7,8)9)14(3,4)16-18(10,11)12/h1-12H3 |
| InChIKey | YJICEDHDICAXTE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|