C46H34F6O7 — CID 20603315
4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoic acid (PubChem CID 20603315) has the molecular formula C46H34F6O7 and a molecular weight of 812.76 g/mol. Its IUPAC name is 4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 20603315 |
| Molecular Formula | C46H34F6O7 |
| Molecular Weight | 812.76 g/mol |
| Exact Mass | 812.22 |
| IUPAC Name | 4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoic acid |
| SMILES | CC(c1ccc(OCc2ccc(OC(F)=C(F)F)cc2)cc1)(c1ccc(OCc2ccc(OC(F)=C(F)F)cc2)cc1)c1ccc(OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C46H34F6O7/c1-46(33-10-20-36(21-11-33)55-26-29-2-8-32(9-3-29)45(53)54,34-12-22-37(23-13-34)56-27-30-4-16-39(17-5-30)58-43(51)41(47)48)35-14-24-38(25-15-35)57-28-31-6-18-40(19-7-31)59-44(52)42(49)50/h2-25H,26-28H2,1H3,(H,53,54) |
| InChIKey | UOHIYKPMOUPMPD-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.76 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|