C47H36F6O7 — CID 20603317
methyl 4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoate (PubChem CID 20603317) has the molecular formula C47H36F6O7 and a molecular weight of 826.79 g/mol. Its IUPAC name is methyl 4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 20603317 |
| Molecular Formula | C47H36F6O7 |
| Molecular Weight | 826.79 g/mol |
| Exact Mass | 826.24 |
| IUPAC Name | methyl 4-[[4-[1,1-bis[4-[[4-(1,2,2-trifluoroethenoxy)phenyl]methoxy]phenyl]ethyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(C(C)(c3ccc(OCc4ccc(OC(F)=C(F)F)cc4)cc3)c3ccc(OCc4ccc(OC(F)=C(F)F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H36F6O7/c1-47(34-11-21-37(22-12-34)56-27-30-3-9-33(10-4-30)46(54)55-2,35-13-23-38(24-14-35)57-28-31-5-17-40(18-6-31)59-44(52)42(48)49)36-15-25-39(26-16-36)58-29-32-7-19-41(20-8-32)60-45(53)43(50)51/h3-26H,27-29H2,1-2H3 |
| InChIKey | MVQZLGNBMBECFD-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.79 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|