C9H17N — CID 20603577
(2E,5E)-N,N-dimethylhepta-2,5-dien-1-amine (PubChem CID 20603577) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (2E,5E)-N,N-dimethylhepta-2,5-dien-1-amine.
| Compound Name | (2E,5E)-N,N-dimethylhepta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 20603577 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (2E,5E)-N,N-dimethylhepta-2,5-dien-1-amine |
| SMILES | C/C=C/C/C=C/CN(C)C |
| InChI | InChI=1S/C9H17N/c1-4-5-6-7-8-9-10(2)3/h4-5,7-8H,6,9H2,1-3H3/b5-4+,8-7+ |
| InChIKey | OZWMQBKNDQYCNJ-AOSYACOCSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|