About 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione
7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione (PubChem CID 20603787) has the molecular formula C17H23N4O6+
and a molecular weight of 379.39 g/mol. Its IUPAC name is 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione.
Molecular Properties
| Compound Name | 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione |
| PubChem CID | 20603787 |
| Molecular Formula | C17H23N4O6+ |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione |
| SMILES | O=C=NCCCCCCN1C(=O)OC(=O)[N+]2(CCCCCC2N=C=O)C1=O |
| InChI | InChI=1S/C17H23N4O6/c22-12-18-9-5-1-2-6-10-20-15(24)21(17(26)27-16(20)25)11-7-3-4-8-14(21)19-13-23/h14H,1-11H2/q+1 |
| InChIKey | QOMIISWOAIJCGO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione?
The IUPAC name of 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione (CID 20603787) is 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione.
What is the SMILES notation for 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione?
The canonical SMILES for 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione is O=C=NCCCCCCN1C(=O)OC(=O)[N+]2(CCCCCC2N=C=O)C1=O.
What is the InChIKey of 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione?
The InChIKey is QOMIISWOAIJCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N4O6/c22-12-18-9-5-1-2-6-10-20-15(24)21(17(26)27-16(20)25)11-7-3-4-8-14(21)19-13-23/h14H,1-11H2/q+1.
What are the key properties of 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione?
7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione has a molecular weight of 379.39 g/mol, XLogP of 2.63, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-isocyanato-4-(6-isocyanatohexyl)-2-oxa-4-aza-6-azoniaspiro[5.6]dodecane-1,3,5-trione is sourced from PubChem (CID 20603787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).