About N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine
N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 20604253) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine |
| PubChem CID | 20604253 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | CC(C)Nc1nc(C(C)C)nc2cccnc12 |
| InChI | InChI=1S/C13H18N4/c1-8(2)12-16-10-6-5-7-14-11(10)13(17-12)15-9(3)4/h5-9H,1-4H3,(H,15,16,17) |
| InChIKey | QQMYPPJINICUIK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine?
The IUPAC name of N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine (CID 20604253) is N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine is CC(C)Nc1nc(C(C)C)nc2cccnc12.
What is the InChIKey of N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine?
The InChIKey is QQMYPPJINICUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c1-8(2)12-16-10-6-5-7-14-11(10)13(17-12)15-9(3)4/h5-9H,1-4H3,(H,15,16,17).
What are the key properties of N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine?
N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine has a molecular weight of 230.31 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-di(propan-2-yl)pyrido[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 20604253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).