C22H23F3N4O4 — CID 20604471
7-methoxy-1-(2-morpholin-4-ylethyl)-N-[2-(trifluoromethoxy)phenyl]indazole-3-carboxamide (PubChem CID 20604471) has the molecular formula C22H23F3N4O4 and a molecular weight of 464.44 g/mol. Its IUPAC name is 7-methoxy-1-(2-morpholin-4-ylethyl)-N-[2-(trifluoromethoxy)phenyl]indazole-3-carboxamide.
| Compound Name | 7-methoxy-1-(2-morpholin-4-ylethyl)-N-[2-(trifluoromethoxy)phenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 20604471 |
| Molecular Formula | C22H23F3N4O4 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 7-methoxy-1-(2-morpholin-4-ylethyl)-N-[2-(trifluoromethoxy)phenyl]indazole-3-carboxamide |
| SMILES | COc1cccc2c(C(=O)Nc3ccccc3OC(F)(F)F)nn(CCN3CCOCC3)c12 |
| InChI | InChI=1S/C22H23F3N4O4/c1-31-18-8-4-5-15-19(27-29(20(15)18)10-9-28-11-13-32-14-12-28)21(30)26-16-6-2-3-7-17(16)33-22(23,24)25/h2-8H,9-14H2,1H3,(H,26,30) |
| InChIKey | PDEOYIAXDGSLSJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |