About (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate
(3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate (PubChem CID 20604808) has the molecular formula C17H14BrNO4S
and a molecular weight of 408.27 g/mol. Its IUPAC name is (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate.
Molecular Properties
| Compound Name | (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate |
| PubChem CID | 20604808 |
| Molecular Formula | C17H14BrNO4S |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Oc1cc2ccccc2cc1N |
| InChI | InChI=1S/C17H14BrNO4S/c1-22-15-7-6-13(18)10-17(15)24(20,21)23-16-9-12-5-3-2-4-11(12)8-14(16)19/h2-10H,19H2,1H3 |
| InChIKey | RYVHRQKBKJLQCZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate?
The IUPAC name of (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate (CID 20604808) is (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate.
What is the SMILES notation for (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate?
The canonical SMILES for (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate is COc1ccc(Br)cc1S(=O)(=O)Oc1cc2ccccc2cc1N.
What is the InChIKey of (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate?
The InChIKey is RYVHRQKBKJLQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO4S/c1-22-15-7-6-13(18)10-17(15)24(20,21)23-16-9-12-5-3-2-4-11(12)8-14(16)19/h2-10H,19H2,1H3.
What are the key properties of (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate?
(3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate has a molecular weight of 408.27 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminonaphthalen-2-yl) 5-bromo-2-methoxybenzenesulfonate is sourced from PubChem (CID 20604808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).