About 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine
2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 2060523) has the molecular formula C14H22N4
and a molecular weight of 246.36 g/mol. Its IUPAC name is 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 2060523 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(C)(C)c1cc(N)n2nc(C(C)(C)C)cc2n1 |
| InChI | InChI=1S/C14H22N4/c1-13(2,3)9-7-11(15)18-12(16-9)8-10(17-18)14(4,5)6/h7-8H,15H2,1-6H3 |
| InChIKey | SAUFGSXNXZLMQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine (CID 2060523) is 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine is CC(C)(C)c1cc(N)n2nc(C(C)(C)C)cc2n1.
What is the InChIKey of 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is SAUFGSXNXZLMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4/c1-13(2,3)9-7-11(15)18-12(16-9)8-10(17-18)14(4,5)6/h7-8H,15H2,1-6H3.
What are the key properties of 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine?
2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 246.36 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 2060523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).