C6H10N2S — CID 20605582
3-methyl-5-propan-2-yl-1,2,4-thiadiazole (PubChem CID 20605582) has the molecular formula C6H10N2S and a molecular weight of 142.23 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-1,2,4-thiadiazole.
| Compound Name | 3-methyl-5-propan-2-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 20605582 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 3-methyl-5-propan-2-yl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(C(C)C)n1 |
| InChI | InChI=1S/C6H10N2S/c1-4(2)6-7-5(3)8-9-6/h4H,1-3H3 |
| InChIKey | JTCYCGMDQMUQRP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |