C47H42FN5O6P2 — CID 20605777
[fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-phenyldiazenylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate (PubChem CID 20605777) has the molecular formula C47H42FN5O6P2 and a molecular weight of 853.80 g/mol. Its IUPAC name is [fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-phenyldiazenylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate.
| Compound Name | [fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-phenyldiazenylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 20605777 |
| Molecular Formula | C47H42FN5O6P2 |
| Molecular Weight | 853.80 g/mol |
| Exact Mass | 853.26 |
| IUPAC Name | [fluoro(phosphanyl)phosphanyl] 6-[2-[N-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-phenyldiazenylanilino]acetyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylate |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCN(CC(=O)N4CCC5=C4C=CC6=C5C=C(N6)C(=O)OP(F)P)C7=CC=C(C=C7)N=NC8=CC=CC=C8 |
| InChI | InChI=1S/C47H42FN5O6P2/c1-56-38-21-13-33(14-22-38)47(32-9-5-3-6-10-32,34-15-23-39(57-2)24-16-34)58-31-52(37-19-17-36(18-20-37)51-50-35-11-7-4-8-12-35)30-45(54)53-28-27-40-41-29-43(46(55)59-61(48)60)49-42(41)25-26-44(40)53/h3-26,29,49H,27-28,30-31,60H2,1-2H3 |
| InChIKey | MWCHZJGTLYAWGH-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | 1410 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.80 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|