C10H10F4O3S — CID 2060597
2,2,3,3-tetrafluoropropyl 4-methylbenzenesulfonate (PubChem CID 2060597) has the molecular formula C10H10F4O3S and a molecular weight of 286.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-methylbenzenesulfonate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2060597 |
| Molecular Formula | C10H10F4O3S |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H10F4O3S/c1-7-2-4-8(5-3-7)18(15,16)17-6-10(13,14)9(11)12/h2-5,9H,6H2,1H3 |
| InChIKey | IMDNPHAMGJIKNV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|